ChemNet > CAS > 85199-06-0 2,5-Dimethylbenzeneboronic acid
85199-06-0 2,5-Dimethylbenzeneboronic acid
| نام محصول |
2,5-Dimethylbenzeneboronic acid |
| نام انگلیسی |
2,5-Dimethylbenzeneboronic acid; 2,5-Dimethylphenylboronic acid; P-XYLENE-2-BORONIC ACID |
| میدان مغناطیسی |
C8H11BO2 |
| وزن مولکولی |
149.9827 |
| InChI |
InChI=1/C8H11BO2/c1-6-3-4-7(2)8(5-6)9(10)11/h3-5,10-11H,1-2H3 |
| شماره سیایاس |
85199-06-0 |
| ساختار مولکولی |
|
| تراکم |
1.07g/cm3 |
| نقطه ذوب |
186-191℃ |
| نقطه غلیان |
305.1°C at 760 mmHg |
| ضریب شکست |
1.523 |
| نقطه اشتعال |
138.3°C |
| فشار بخار |
0.000367mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
