ChemNet > CAS > 868-54-2 2-Amino-1-propene-1,1,3-tricarbonitrile
868-54-2 2-Amino-1-propene-1,1,3-tricarbonitrile
| نام محصول |
2-Amino-1-propene-1,1,3-tricarbonitrile |
| نام انگلیسی |
2-Amino-1-propene-1,1,3-tricarbonitrile; 2-aminoprop-1-ene-1,1,3-tricarbonitrile |
| میدان مغناطیسی |
C6H4N4 |
| وزن مولکولی |
132.1228 |
| InChI |
InChI=1/C6H4N4/c7-2-1-6(10)5(3-8)4-9/h5,10H,1H2/b10-6+ |
| شماره سیایاس |
868-54-2 |
| تعداد کمیسیون اروپایی |
212-777-5 |
| ساختار مولکولی |
|
| تراکم |
1.13g/cm3 |
| نقطه ذوب |
171-173℃ |
| نقطه غلیان |
454.9°C at 760 mmHg |
| ضریب شکست |
1.565 |
| نقطه اشتعال |
228.9°C |
| فشار بخار |
1.84E-08mmHg at 25°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|
