87-82-1 Hexabromobenzene
نام محصول |
Hexabromobenzene |
نام انگلیسی |
Hexabromobenzene;AI3-60220; CCRIS 5917; HSDB 2912; NSC 113975; Benzene, 1,2,3,4,5,6-hexabromo-; Benzene, hexabromo- |
میدان مغناطیسی |
C6Br6 |
وزن مولکولی |
551.49
|
InChI |
InChI=1/C6Br6/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
شماره سیایاس |
87-82-1 |
تعداد کمیسیون اروپایی |
201-773-9 |
ساختار مولکولی |
|
نقطه ذوب |
326-327℃ |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|