ChemNet > CAS > 874-87-3 p-(Methylthio)benzyl chloride
874-87-3 p-(Methylthio)benzyl chloride
نام محصول |
p-(Methylthio)benzyl chloride |
نام انگلیسی |
p-(Methylthio)benzyl chloride; 4-(Methylthio)benzyl chloride; 4-(Chloromethyl)thioanisole; 1-(chloromethyl)-4-(methylsulfanyl)benzene |
میدان مغناطیسی |
C8H9ClS |
وزن مولکولی |
172.6751 |
InChI |
InChI=1/C8H9ClS/c1-10-8-4-2-7(6-9)3-5-8/h2-5H,6H2,1H3 |
شماره سیایاس |
874-87-3 |
تعداد کمیسیون اروپایی |
212-870-0 |
ساختار مولکولی |
|
تراکم |
1.16g/cm3 |
نقطه غلیان |
262.3°C at 760 mmHg |
ضریب شکست |
1.574 |
نقطه اشتعال |
110.5°C |
فشار بخار |
0.0179mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R34:Causes burns.;
R36:Irritating to eyes.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|