ChemNet > CAS > 89466-08-0 2-Hydroxybenzeneboronic acid
89466-08-0 2-Hydroxybenzeneboronic acid
نام محصول |
2-Hydroxybenzeneboronic acid |
نام انگلیسی |
2-Hydroxybenzeneboronic acid; 2-Boronophenol; 2-Hydroxyphenylboronic acid |
میدان مغناطیسی |
C6H7BO3 |
وزن مولکولی |
137.929 |
InChI |
InChI=1/C6H7BO3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8-10H |
شماره سیایاس |
89466-08-0 |
ساختار مولکولی |
|
تراکم |
1.32g/cm3 |
نقطه غلیان |
327.3°C at 760 mmHg |
ضریب شکست |
1.582 |
نقطه اشتعال |
151.7°C |
فشار بخار |
8.28E-05mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|