9009-54-5 Polyurethane
نام محصول |
Polyurethane |
نام انگلیسی |
Polyurethane; Polyurethane foam; Polyurethane foams; Polyisocyanurate resins; Polyurethanes, cellular; PU foam; The following companies react isocyanates or prepolymers with polyols to produce polyurethane foams. The list is incomplete.; POLYURETHANEOLIGOMERS; POLYURETHANEVARNISH; PU; Acrylic polyurethane paint; Acrylic polyurethane anticorrosive coating; Polyurethane mixed component; 1-ethylurea |
میدان مغناطیسی |
C3H8N2O |
وزن مولکولی |
88.1084 |
InChI |
InChI=1/C3H8N2O/c1-2-5-3(4)6/h2H2,1H3,(H3,4,5,6) |
شماره سیایاس |
9009-54-5 |
تعداد کمیسیون اروپایی |
210-898-8 |
ساختار مولکولی |
|
تراکم |
1.005g/cm3 |
نقطه غلیان |
136.3°C at 760 mmHg |
ضریب شکست |
1.44 |
نقطه اشتعال |
36.2°C |
فشار بخار |
7.44mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
|
|