927-67-3 n-Propylthiourea
نام محصول |
n-Propylthiourea |
نام انگلیسی |
n-Propylthiourea;Propyl-2-thiourea; Propylthiourea; Thiourea, propyl-; 1-propylthiourea |
میدان مغناطیسی |
C4H10N2S |
وزن مولکولی |
118.2006 |
InChI |
InChI=1/C4H10N2S/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7) |
شماره سیایاس |
927-67-3 |
تعداد کمیسیون اروپایی |
213-158-2 |
ساختار مولکولی |
|
تراکم |
1.054g/cm3 |
نقطه غلیان |
182.1°C at 760 mmHg |
ضریب شکست |
1.537 |
نقطه اشتعال |
63.9°C |
فشار بخار |
0.825mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|