ChemNet > CAS > 931-17-9 1,2-Cyclohexanediol, mixture of cis and trans
931-17-9 1,2-Cyclohexanediol, mixture of cis and trans
نام محصول |
1,2-Cyclohexanediol, mixture of cis and trans |
نام انگلیسی |
1,2-Cyclohexanediol, mixture of cis and trans; 1,2-Cyclohexanediol, cis/trans-mix; 1,2-Cyclohexanediol; 1,2-Cyclohexandiol |
میدان مغناطیسی |
C6H12O2 |
وزن مولکولی |
116.16 |
InChI |
InChI=1/C6H12O2/c7-5-3-1-2-4-6(5)8/h5-8H,1-4H2 |
شماره سیایاس |
931-17-9 |
تعداد کمیسیون اروپایی |
213-229-8 |
ساختار مولکولی |
|
نقطه ذوب |
73-77℃ |
نقطه غلیان |
118-120℃ (10 mmHg) |
حلالیت آب |
soluble |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S23:;
S24/25:;
|
|