943-93-1 1,2-Epoxy-5,9-cyclododecadiene

نام محصول	1,2-Epoxy-5,9-cyclododecadiene
نام انگلیسی	1,2-Epoxy-5,9-cyclododecadiene;
میدان مغناطیسی	C₁₂H₁₈O
وزن مولکولی	178.2707
InChI	InChI=1/C12H18O/c1-2-4-6-8-10-12-11(13-12)9-7-5-3-1/h3-6,11-12H,1-2,7-10H2/b5-3+,6-4+
شماره سیایاس	943-93-1
تعداد کمیسیون اروپایی	213-407-5
ساختار مولکولی
تراکم	0.941g/cm³
نقطه غلیان	269.8°C at 760 mmHg
ضریب شکست	1.484
نقطه اشتعال	113.6°C
فشار بخار	0.0118mmHg at 25°C
خطر نمادها
کدهای خطر	R36/38:Irritating to eyes and skin.;
توضیحات ایمنی	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;