ChemNet > CAS > 95735-63-0 2-(3,4-Dimethoxyphenylthio)acetic acid
95735-63-0 2-(3,4-Dimethoxyphenylthio)acetic acid
| نام محصول |
2-(3,4-Dimethoxyphenylthio)acetic acid |
| نام انگلیسی |
2-(3,4-Dimethoxyphenylthio)acetic acid; 2-[(3,4-dimethoxyphenyl)thio]acetic acid; [(3,4-dimethoxyphenyl)sulfanyl]acetic acid; [(3,4-dimethoxyphenyl)sulfanyl]acetate |
| میدان مغناطیسی |
C10H11O4S |
| وزن مولکولی |
227.2575 |
| InChI |
InChI=1/C10H12O4S/c1-13-8-4-3-7(5-9(8)14-2)15-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)/p-1 |
| شماره سیایاس |
95735-63-0 |
| ساختار مولکولی |
|
| نقطه ذوب |
101-103℃ |
| نقطه غلیان |
376.4°C at 760 mmHg |
| نقطه اشتعال |
181.4°C |
| فشار بخار |
2.47E-06mmHg at 25°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
