ChemNet > CAS > 97914-59-5 2-(Difluoromethoxy)benzoic acid
97914-59-5 2-(Difluoromethoxy)benzoic acid
نام محصول |
2-(Difluoromethoxy)benzoic acid |
نام انگلیسی |
2-(Difluoromethoxy)benzoic acid; 2-(Difluorometoxy)benzoic acid; 2-(difluoromethoxy)benzoate |
میدان مغناطیسی |
C8H6F2O3 |
وزن مولکولی |
188.1282 |
InChI |
InChI=1/C8H6F2O3/c9-8(10)13-6-4-2-1-3-5(6)7(11)12/h1-4,8H,(H,11,12) |
شماره سیایاس |
97914-59-5 |
ساختار مولکولی |
|
تراکم |
1.37g/cm3 |
نقطه غلیان |
273.6°C at 760 mmHg |
ضریب شکست |
1.496 |
نقطه اشتعال |
119.3°C |
فشار بخار |
0.00276mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|