98-81-7 alpha-bromostyrene
نام محصول |
alpha-bromostyrene |
نام انگلیسی |
alpha-bromostyrene; 1-(1-Bromovinyl)benzene; (1-bromoethenyl)benzene |
میدان مغناطیسی |
C8H7Br |
وزن مولکولی |
183.0452 |
InChI |
InChI=1/C8H7Br/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2 |
شماره سیایاس |
98-81-7 |
تعداد کمیسیون اروپایی |
202-702-4 |
ساختار مولکولی |
|
تراکم |
1.387g/cm3 |
نقطه ذوب |
-44℃ |
نقطه غلیان |
212.6°C at 760 mmHg |
ضریب شکست |
1.574 |
نقطه اشتعال |
98.3°C |
فشار بخار |
0.249mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|