ChemNet > CAS > 1006-39-9 2-bromo-4-fluoroacetophenone
1006-39-9 2-bromo-4-fluoroacetophenone
| Nome del prodotto |
2-bromo-4-fluoroacetophenone |
| Nome inglese |
2-bromo-4-fluoroacetophenone; 2'-bromo-4'-fluoroacetophenone; 1-(2-bromo-4-fluorophenyl)ethanone |
| Formula molecolare |
C8H6BrFO |
| Peso Molecolare |
217.035 |
| InChI |
InChI=1/C8H6BrFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
| Numero CAS |
1006-39-9 |
| EINECS |
222-263-2 |
| Struttura molecolare |
|
| Densità |
1.535g/cm3 |
| Punto di ebollizione |
258.4°C at 760 mmHg |
| Indice di rifrazione |
1.534 |
| Punto d'infiammabilità |
110.1°C |
| Pressione di vapore |
0.0138mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
