ChemNet > CAS > 102-85-2 Tributyl phosphite
102-85-2 Tributyl phosphite
| Nome del prodotto |
Tributyl phosphite |
| Nome inglese |
Tributyl phosphite; Tri-n-butyl phosphite |
| Formula molecolare |
C12H27O3P |
| Peso Molecolare |
250.3147 |
| InChI |
InChI=1/C12H27O3P/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-12H2,1-3H3 |
| Numero CAS |
102-85-2 |
| EINECS |
203-061-3 |
| Struttura molecolare |
|
| Punto di fusione |
-80℃ |
| Punto di ebollizione |
268.1°C at 760 mmHg |
| Punto d'infiammabilità |
121.1°C |
| Pressione di vapore |
0.013mmHg at 25°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R21:Harmful in contact with skin.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
