ChemNet > CAS > 10595-06-9 2-Phenoxyethyl methacrylate
10595-06-9 2-Phenoxyethyl methacrylate
| Nome del prodotto |
2-Phenoxyethyl methacrylate |
| Nome inglese |
2-Phenoxyethyl methacrylate; |
| Formula molecolare |
C12H14O3 |
| Peso Molecolare |
206.2378 |
| InChI |
InChI=1/C12H14O3/c1-9(2)12(13)15-10(3)14-11-7-5-4-6-8-11/h4-8,10H,1H2,2-3H3 |
| Numero CAS |
10595-06-9 |
| EINECS |
234-201-1 |
| Struttura molecolare |
|
| Densità |
1.059g/cm3 |
| Punto di ebollizione |
292.352°C at 760 mmHg |
| Indice di rifrazione |
1.501 |
| Punto d'infiammabilità |
118.277°C |
| Pressione di vapore |
0.002mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|
