ChemNet > CAS > 1073-29-6 2-Hydroxythioanisole
1073-29-6 2-Hydroxythioanisole
| Nome del prodotto |
2-Hydroxythioanisole |
| Nome inglese |
2-Hydroxythioanisole; 2-(Methylmercapto)phenol; 2-(Methylthio)phenol; 2-(Methylthio)-phenol; 2-(methylsulfanyl)phenol; 2-Methylthio phenol; O-(methylthio)phenol |
| Formula molecolare |
C7H8OS |
| Peso Molecolare |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
| Numero CAS |
1073-29-6 |
| EINECS |
214-027-2 |
| Struttura molecolare |
|
| Densità |
1.19g/cm3 |
| Punto di ebollizione |
206.1°C at 760 mmHg |
| Indice di rifrazione |
1.613 |
| Punto d'infiammabilità |
108°C |
| Pressione di vapore |
0.168mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
