ChemNet > CAS > 1078-05-3 4-Nitronicotinic acid N-oxide
1078-05-3 4-Nitronicotinic acid N-oxide
| Nome del prodotto |
4-Nitronicotinic acid N-oxide |
| Nome inglese |
4-Nitronicotinic acid N-oxide; 4-Nitropyridine-3-carboxylic acid N-oxide; 4-nitropyridine-3-carboxylic acid 1-oxide |
| Formula molecolare |
C6H4N2O5 |
| Peso Molecolare |
184.1064 |
| InChI |
InChI=1/C6H4N2O5/c9-6(10)4-3-7(11)2-1-5(4)8(12)13/h1-3H,(H,9,10) |
| Numero CAS |
1078-05-3 |
| Struttura molecolare |
|
| Densità |
1.69g/cm3 |
| Punto di ebollizione |
553.6°C at 760 mmHg |
| Indice di rifrazione |
1.653 |
| Punto d'infiammabilità |
288.6°C |
| Pressione di vapore |
4.33E-13mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
