ChemNet > CAS > 1078-61-1 3,4-dihydroxyphenylpropionic acid
1078-61-1 3,4-dihydroxyphenylpropionic acid
| Nome del prodotto |
3,4-dihydroxyphenylpropionic acid |
| Nome inglese |
3,4-dihydroxyphenylpropionic acid; 3-(3,4-Dihydroxyphenyl)propionic acid; 3,4-Dihydroxyhydrocinnamic acid; Hydrocaffeic acid; 3-(3,4-dihydroxyphenyl)propanoic acid; 3-(3,4-dihydroxyphenyl)propanoate; 3,4-Dihydroxybenzenepropanoic acid |
| Formula molecolare |
C9H9O4 |
| Peso Molecolare |
181.1659 |
| InChI |
InChI=1/C9H10O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5,10-11H,2,4H2,(H,12,13)/p-1 |
| Numero CAS |
1078-61-1 |
| EINECS |
214-083-8 |
| Struttura molecolare |
|
| Punto di ebollizione |
417.5°C at 760 mmHg |
| Punto d'infiammabilità |
220.4°C |
| Pressione di vapore |
1.02E-07mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
