ChemNet > CAS > 110-36-1 butyl myristate
110-36-1 butyl myristate
| Nome del prodotto |
butyl myristate |
| Nome inglese |
butyl myristate; n-Butyl myristate~Myristic acid n-butyl ester~Teradecanoic acid n-butyl ester; Myristicacidnbutylester; Myristic acid n-butyl ester; butyl tetradecanoate |
| Formula molecolare |
C18H36O2 |
| Peso Molecolare |
284.4772 |
| InChI |
InChI=1/C18H36O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18(19)20-17-6-4-2/h3-17H2,1-2H3 |
| Numero CAS |
110-36-1 |
| EINECS |
203-759-8 |
| Struttura molecolare |
|
| Densità |
0.864g/cm3 |
| Punto di ebollizione |
334.7°C at 760 mmHg |
| Indice di rifrazione |
1.442 |
| Punto d'infiammabilità |
158.5°C |
| Pressione di vapore |
0.000126mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
