ChemNet > CAS > 110127-07-6 2,6-Dibromo-4-nitrotoluene
110127-07-6 2,6-Dibromo-4-nitrotoluene
| Nome del prodotto |
2,6-Dibromo-4-nitrotoluene |
| Nome inglese |
2,6-Dibromo-4-nitrotoluene;1,3-dibromo-2-methyl-5-nitrobenzene |
| Formula molecolare |
C7H5Br2NO2 |
| Peso Molecolare |
294.9281 |
| InChI |
InChI=1/C7H5Br2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
| Numero CAS |
110127-07-6 |
| Struttura molecolare |
|
| Densità |
1.967g/cm3 |
| Punto di ebollizione |
320.4°C at 760 mmHg |
| Indice di rifrazione |
1.625 |
| Punto d'infiammabilità |
147.6°C |
| Pressione di vapore |
0.000598mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
