ChemNet > CAS > 1186-52-3 Acetic-d3 acid-d
1186-52-3 Acetic-d3 acid-d
| Nome del prodotto |
Acetic-d3 acid-d |
| Nome inglese |
Acetic-d3 acid-d; |
| Formula molecolare |
C2D4O2 |
| Peso Molecolare |
64.0766 |
| InChI |
InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i1D3/hD |
| Numero CAS |
1186-52-3 |
| EINECS |
214-693-4 |
| Struttura molecolare |
|
| Densità |
1.14g/cm3 |
| Punto di fusione |
15-16℃ |
| Punto di ebollizione |
117.1°C at 760 mmHg |
| Indice di rifrazione |
1.375 |
| Punto d'infiammabilità |
40°C |
| Pressione di vapore |
13.9mmHg at 25°C |
| Simboli di pericolo |
 C:Corrosive;
|
| Codici di Rischio |
R10:Flammable.;
R35:Causes severe burns.;
|
| Sicurezza Descrizione |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
