ChemNet > CAS > 121219-12-3 4-n-Pentylbenzeneboronic acid
121219-12-3 4-n-Pentylbenzeneboronic acid
| Nome del prodotto |
4-n-Pentylbenzeneboronic acid |
| Nome inglese |
4-n-Pentylbenzeneboronic acid; 4-n-Amylbenzeneboronic acid; 4-n-Pentylphenylboronic acid; (4-pentylphenyl)boronic acid; 4-Pentylbenzeneboronic acid |
| Formula molecolare |
C11H17BO2 |
| Peso Molecolare |
192.0625 |
| InChI |
InChI=1/C11H17BO2/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9,13-14H,2-5H2,1H3 |
| Numero CAS |
121219-12-3 |
| Struttura molecolare |
|
| Densità |
1.01g/cm3 |
| Punto di ebollizione |
328°C at 760 mmHg |
| Indice di rifrazione |
1.509 |
| Punto d'infiammabilità |
152.2°C |
| Pressione di vapore |
7.85E-05mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
