ChemNet > CAS > 122033-54-9 4-Bromo-2,3,5,6-tetrafluorobenzoylchloride
122033-54-9 4-Bromo-2,3,5,6-tetrafluorobenzoylchloride
| Nome del prodotto |
4-Bromo-2,3,5,6-tetrafluorobenzoylchloride |
| Nome inglese |
4-Bromo-2,3,5,6-tetrafluorobenzoylchloride; 4-Bromo-2,3,5,6-tetrafluorobenzoyl chloride |
| Formula molecolare |
C7BrClF4O |
| Peso Molecolare |
291.4249 |
| InChI |
InChI=1/C7BrClF4O/c8-2-5(12)3(10)1(7(9)14)4(11)6(2)13 |
| Numero CAS |
122033-54-9 |
| Struttura molecolare |
|
| Densità |
1.957g/cm3 |
| Punto di ebollizione |
216.5°C at 760 mmHg |
| Indice di rifrazione |
1.505 |
| Punto d'infiammabilità |
84.8°C |
| Pressione di vapore |
0.139mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
