ChemNet > CAS > 13029-09-9 2,2'-Dibromobiphenyl
13029-09-9 2,2'-Dibromobiphenyl
| Nome del prodotto |
2,2'-Dibromobiphenyl |
| Nome inglese |
2,2'-Dibromobiphenyl; 2,2-Dibromophenyl; 2,2-Dibromobiphenyl; 2,2'-dibromodiphenyl; 2,2'-Dibromo-1,1'-Biphenyl |
| Formula molecolare |
C12H8Br2 |
| Peso Molecolare |
311.9999 |
| InChI |
InChI=1/C12H8Br2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H |
| Numero CAS |
13029-09-9 |
| Struttura molecolare |
|
| Densità |
1.667g/cm3 |
| Punto di fusione |
79℃ |
| Punto di ebollizione |
332.9°C at 760 mmHg |
| Indice di rifrazione |
1.625 |
| Punto d'infiammabilità |
180°C |
| Pressione di vapore |
0.000274mmHg at 25°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
