ChemNet > CAS > 135159-25-0 2,4,6-Trimethoxybenzeneboronic acid
135159-25-0 2,4,6-Trimethoxybenzeneboronic acid
| Nome del prodotto |
2,4,6-Trimethoxybenzeneboronic acid |
| Nome inglese |
2,4,6-Trimethoxybenzeneboronic acid; 2,4,6-Trimethoxyphenylboronic acid |
| Formula molecolare |
C9H13BO5 |
| Peso Molecolare |
212.0075 |
| InChI |
InChI=1/C9H13BO5/c1-13-6-4-7(14-2)9(10(11)12)8(5-6)15-3/h4-5,11-12H,1-3H3 |
| Numero CAS |
135159-25-0 |
| Struttura molecolare |
|
| Densità |
1.21g/cm3 |
| Punto di ebollizione |
413.8°C at 760 mmHg |
| Indice di rifrazione |
1.513 |
| Punto d'infiammabilità |
204.1°C |
| Pressione di vapore |
1.37E-07mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
