ChemNet > CAS > 140675-43-0 2-Fluoro-6-hydroxybenzonitrile
140675-43-0 2-Fluoro-6-hydroxybenzonitrile
| Nome del prodotto |
2-Fluoro-6-hydroxybenzonitrile |
| Nome inglese |
2-Fluoro-6-hydroxybenzonitrile; 2-Cyano-3-fluorophenol; 2-fluoro-6-hydroxybenzonitrle |
| Formula molecolare |
C8H5FO |
| Peso Molecolare |
136.1231 |
| InChI |
InChI=1/C8H5FO/c1-2-6-7(9)4-3-5-8(6)10/h1,3-5,10H |
| Numero CAS |
140675-43-0 |
| Struttura molecolare |
|
| Indice di rifrazione |
1.56 |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
