ChemNet > CAS > 143879-77-0 2,6-Difluoro-3-nitrobenzonitrile
143879-77-0 2,6-Difluoro-3-nitrobenzonitrile
| Nome del prodotto |
2,6-Difluoro-3-nitrobenzonitrile |
| Nome inglese |
2,6-Difluoro-3-nitrobenzonitrile; |
| Formula molecolare |
C7H2F2N2O2 |
| Peso Molecolare |
184.0998 |
| InChI |
InChI=1/C7H2F2N2O2/c8-5-1-2-6(11(12)13)7(9)4(5)3-10/h1-2H |
| Numero CAS |
143879-77-0 |
| Struttura molecolare |
|
| Densità |
1.51g/cm3 |
| Punto di ebollizione |
263.7°C at 760 mmHg |
| Indice di rifrazione |
1.529 |
| Punto d'infiammabilità |
113.3°C |
| Pressione di vapore |
0.0101mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
