ChemNet > CAS > 14444-77-0 Diethyl phenyl orthoformate
14444-77-0 Diethyl phenyl orthoformate
| Nome del prodotto |
Diethyl phenyl orthoformate |
| Nome inglese |
Diethyl phenyl orthoformate; Orthoformic acid diethyl phenyl ester; (diethoxymethoxy)benzene |
| Formula molecolare |
C11H16O3 |
| Peso Molecolare |
196.2429 |
| InChI |
InChI=1/C11H16O3/c1-3-12-11(13-4-2)14-10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3 |
| Numero CAS |
14444-77-0 |
| EINECS |
238-421-9 |
| Struttura molecolare |
|
| Densità |
1.019g/cm3 |
| Punto di ebollizione |
235.2°C at 760 mmHg |
| Indice di rifrazione |
1.482 |
| Punto d'infiammabilità |
57.2°C |
| Pressione di vapore |
0.0777mmHg at 25°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
