ChemNet > CAS > 14979-39-6 4-Methyl-3-heptanol
14979-39-6 4-Methyl-3-heptanol
| Nome del prodotto |
4-Methyl-3-heptanol |
| Nome inglese |
4-Methyl-3-heptanol; 4-Methyl-3-heptanol,mixture of isomers; Ethyl 2-pentyl carbinol; 4-methylheptan-3-ol; (3R,4S)-4-methylheptan-3-ol; (3S,4S)-4-methylheptan-3-ol; (3R,4R)-4-methylheptan-3-ol; (3S,4R)-4-methylheptan-3-ol |
| Formula molecolare |
C8H18O |
| Peso Molecolare |
130.2279 |
| InChI |
InChI=1/C8H18O/c1-4-6-7(3)8(9)5-2/h7-9H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| Numero CAS |
14979-39-6 |
| EINECS |
239-058-9 |
| Struttura molecolare |
|
| Densità |
0.819g/cm3 |
| Punto di ebollizione |
158.5°C at 760 mmHg |
| Indice di rifrazione |
1.424 |
| Punto d'infiammabilità |
54.4°C |
| Pressione di vapore |
0.927mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R10:Flammable.;
|
| Sicurezza Descrizione |
S16:Keep away from sources of ignition - No smoking.;
|
|
