ChemNet > CAS > 1504-63-8 4-Nitrocinnamyl alcohol
1504-63-8 4-Nitrocinnamyl alcohol
| Nome del prodotto |
4-Nitrocinnamyl alcohol |
| Nome inglese |
4-Nitrocinnamyl alcohol;2-Propen-1-ol, 3-(4-nitrophenyl)-; 2-Propen-1-ol, 3-(p-nitrophenyl)-; 3-(4-nitrophenyl)prop-2-en-1-ol; (2E)-3-(4-nitrophenyl)prop-2-en-1-ol |
| Formula molecolare |
C9H9NO3 |
| Peso Molecolare |
179.1727 |
| InChI |
InChI=1/C9H9NO3/c11-7-1-2-8-3-5-9(6-4-8)10(12)13/h1-6,11H,7H2/b2-1+ |
| Numero CAS |
1504-63-8 |
| Struttura molecolare |
|
| Densità |
1.282g/cm3 |
| Punto di fusione |
127-128℃ |
| Punto di ebollizione |
325.3°C at 760 mmHg |
| Indice di rifrazione |
1.637 |
| Punto d'infiammabilità |
144.1°C |
| Pressione di vapore |
9.47E-05mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
