ChemNet > CAS > 1517-66-4 (+)-3-Methyl-2-butanol
1517-66-4 (+)-3-Methyl-2-butanol
| Nome del prodotto |
(+)-3-Methyl-2-butanol |
| Nome inglese |
(+)-3-Methyl-2-butanol; (S)-(+)-3-Methyl-2-butanol; (S)-(+)-Isopropyl methyl carbinol; 3-methylbutan-2-ol; (2S)-3-methylbutan-2-ol |
| Formula molecolare |
C5H12O |
| Peso Molecolare |
88.1482 |
| InChI |
InChI=1/C5H12O/c1-4(2)5(3)6/h4-6H,1-3H3/t5-/m0/s1 |
| Numero CAS |
1517-66-4 |
| EINECS |
209-950-2 |
| Struttura molecolare |
|
| Densità |
0.806g/cm3 |
| Punto di ebollizione |
113.6°C at 760 mmHg |
| Indice di rifrazione |
1.402 |
| Punto d'infiammabilità |
26.7°C |
| Pressione di vapore |
10.6mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R10:Flammable.;
R20:Harmful by inhalation.;
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
