ChemNet > CAS > 15205-15-9 2-Chloro-6-fluorobenzylamine
15205-15-9 2-Chloro-6-fluorobenzylamine
| Nome del prodotto |
2-Chloro-6-fluorobenzylamine |
| Nome inglese |
2-Chloro-6-fluorobenzylamine; 1-(2-chloro-6-fluorophenyl)methanamine; (2-chloro-6-fluorophenyl)methanaminium; (2-Chloro-6-fluorophenyl)methanamine; 2-Chloro-6-fluorobenzyl amine |
| Formula molecolare |
C7H8ClFN |
| Peso Molecolare |
160.596 |
| InChI |
InChI=1/C7H7ClFN/c8-6-2-1-3-7(9)5(6)4-10/h1-3H,4,10H2/p+1 |
| Numero CAS |
15205-15-9 |
| EINECS |
239-259-1 |
| Struttura molecolare |
|
| Punto di ebollizione |
211.1°C at 760 mmHg |
| Punto d'infiammabilità |
81.5°C |
| Pressione di vapore |
0.186mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
