ChemNet > CAS > 15219-34-8 Oxalyl bromide
15219-34-8 Oxalyl bromide
| Nome del prodotto |
Oxalyl bromide |
| Nome inglese |
Oxalyl bromide; Ethanedioyl dibromide; Ethanedioyl bromide; NSC 96957; Oxalyl bromide |
| Formula molecolare |
C2Br2O2 |
| Peso Molecolare |
215.8282 |
| InChI |
InChI=1/C2Br2O2/c3-1(5)2(4)6 |
| Numero CAS |
15219-34-8 |
| EINECS |
239-271-7 |
| Struttura molecolare |
|
| Densità |
2.627g/cm3 |
| Punto di fusione |
-19℃ |
| Punto di ebollizione |
118.3°C at 760 mmHg |
| Indice di rifrazione |
1.567 |
| Punto d'infiammabilità |
109.8°C |
| Pressione di vapore |
16.8mmHg at 25°C |
| Simboli di pericolo |
 C:Corrosive;
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
