ChemNet > CAS > 1527-91-9 N-Phenylbenzamidine
1527-91-9 N-Phenylbenzamidine
| Nome del prodotto |
N-Phenylbenzamidine |
| Nome inglese |
N-Phenylbenzamidine; N1-Phenylbenzene-1-carboximidamide; N'-phenylbenzenecarboximidamide; N-[(1Z)-amino(phenyl)methylidene]anilinium |
| Formula molecolare |
C13H13N2 |
| Peso Molecolare |
197.2552 |
| InChI |
InChI=1/C13H12N2/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H,(H2,14,15)/p+1 |
| Numero CAS |
1527-91-9 |
| EINECS |
210-720-9 |
| Struttura molecolare |
|
| Punto di fusione |
118-120℃ |
| Punto di ebollizione |
346.3°C at 760 mmHg |
| Punto d'infiammabilità |
163.3°C |
| Pressione di vapore |
5.8E-05mmHg at 25°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
