ChemNet > CAS > 158414-45-0 (1S,2R)-(+)-2-Aminocyclohexanecarboxylic acid hydrochloride
158414-45-0 (1S,2R)-(+)-2-Aminocyclohexanecarboxylic acid hydrochloride
| Nome del prodotto |
(1S,2R)-(+)-2-Aminocyclohexanecarboxylic acid hydrochloride |
| Nome inglese |
(1S,2R)-(+)-2-Aminocyclohexanecarboxylic acid hydrochloride; (1S,2R)-2-ammoniocyclohexanecarboxylate |
| Formula molecolare |
C7H13NO2 |
| Peso Molecolare |
143.1836 |
| InChI |
InChI=1/C7H13NO2/c8-6-4-2-1-3-5(6)7(9)10/h5-6H,1-4,8H2,(H,9,10)/t5-,6+/m0/s1 |
| Numero CAS |
158414-45-0 |
| Struttura molecolare |
|
| Densità |
1.133g/cm3 |
| Punto di fusione |
233℃ |
| Punto di ebollizione |
280°C at 760 mmHg |
| Indice di rifrazione |
1.503 |
| Punto d'infiammabilità |
123.1°C |
| Pressione di vapore |
0.00103mmHg at 25°C |
| Simboli di pericolo |
 C:Corrosive;
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
