ChemNet > CAS > 1591-30-6 4,4'-Biphenyldicarbonitrile
1591-30-6 4,4'-Biphenyldicarbonitrile
| Nome del prodotto |
4,4'-Biphenyldicarbonitrile |
| Nome inglese |
4,4'-Biphenyldicarbonitrile; 4,4-Dicyanobiphenyl; biphenyl-4,4'-dicarbonitrile |
| Formula molecolare |
C14H8N2 |
| Peso Molecolare |
204.2267 |
| InChI |
InChI=1/C14H8N2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H |
| Numero CAS |
1591-30-6 |
| EINECS |
216-468-6 |
| Struttura molecolare |
|
| Densità |
1.2g/cm3 |
| Punto di fusione |
236-236℃ |
| Punto di ebollizione |
403.5°C at 760 mmHg |
| Indice di rifrazione |
1.631 |
| Punto d'infiammabilità |
199.2°C |
| Pressione di vapore |
1.02E-06mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/22:Harmful by inhalation and if swallowed.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
