ChemNet > CAS > 1604-28-0 6-Methyl-3,5-heptadien-2-one
1604-28-0 6-Methyl-3,5-heptadien-2-one
| Nome del prodotto |
6-Methyl-3,5-heptadien-2-one |
| Nome inglese |
6-Methyl-3,5-heptadien-2-one;3,5-Heptadien-2-one, 6-methyl-; 2-Methylhepta-2,4-dien-6-one; AI3-25071; FEMA No. 3363; Methylheptadienone; 6-Methylhepta-3,5-dien-2-one; (3E)-6-methylhepta-3,5-dien-2-one; (3Z)-6-methylhepta-3,5-dien-2-one |
| Formula molecolare |
C8H12O |
| Peso Molecolare |
124.1803 |
| InChI |
InChI=1/C8H12O/c1-7(2)5-4-6-8(3)9/h4-6H,1-3H3/b6-4- |
| Numero CAS |
1604-28-0 |
| EINECS |
216-507-7 |
| Struttura molecolare |
|
| Densità |
0.858g/cm3 |
| Punto di ebollizione |
193.45°C at 760 mmHg |
| Indice di rifrazione |
1.453 |
| Punto d'infiammabilità |
68.582°C |
| Pressione di vapore |
0.464mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R10:Flammable.;
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
