ChemNet > CAS > 16215-21-7 Butyl 3-mercaptopropionate
16215-21-7 Butyl 3-mercaptopropionate
| Nome del prodotto |
Butyl 3-mercaptopropionate |
| Nome inglese |
Butyl 3-mercaptopropionate; Propanoic acid, 3-mercapto-, butyl ester; Butyl mercaptopropionate; NSC 54830; beta-Mercaptopropionic acid, butyl ester; Propionic acid, 3-mercapto-, butyl ester; butyl 3-sulfanylpropanoate |
| Formula molecolare |
C7H14O2S |
| Peso Molecolare |
162.2499 |
| InChI |
InChI=1/C7H14O2S/c1-2-3-5-9-7(8)4-6-10/h10H,2-6H2,1H3 |
| Numero CAS |
16215-21-7 |
| EINECS |
240-343-5 |
| Struttura molecolare |
|
| Densità |
1.003g/cm3 |
| Punto di ebollizione |
216.9°C at 760 mmHg |
| Indice di rifrazione |
1.458 |
| Punto d'infiammabilità |
93.3°C |
| Pressione di vapore |
0.136mmHg at 25°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
