ChemNet > CAS > 16518-62-0 3-Bromo-N,N-dimethylaniline
16518-62-0 3-Bromo-N,N-dimethylaniline
| Nome del prodotto |
3-Bromo-N,N-dimethylaniline |
| Nome inglese |
3-Bromo-N,N-dimethylaniline; Benzenamine, 3-bromo-N,N-dimethyl-; 4-cyanophenyl benzoate; 3-bromo-N,N-dimethylbenzenamine |
| Formula molecolare |
C8H10BrN |
| Peso Molecolare |
200.0757 |
| InChI |
InChI=1/C8H10BrN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
| Numero CAS |
16518-62-0 |
| Struttura molecolare |
|
| Densità |
1.393g/cm3 |
| Punto di ebollizione |
259.7°C at 760 mmHg |
| Indice di rifrazione |
1.586 |
| Punto d'infiammabilità |
110.8°C |
| Pressione di vapore |
0.0128mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| Sicurezza Descrizione |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
