ChemNet > CAS > 1754-55-8 Ethyl 2,4,6-trimethylbenzoate
1754-55-8 Ethyl 2,4,6-trimethylbenzoate
| Nome del prodotto |
Ethyl 2,4,6-trimethylbenzoate |
| Nome inglese |
Ethyl 2,4,6-trimethylbenzoate; Ethyl mesitoate~2,4,6-Trimethylbenzoic acid ethyl ester |
| Formula molecolare |
C12H16O2 |
| Peso Molecolare |
192.2542 |
| InChI |
InChI=1/C12H16O2/c1-5-14-12(13)11-9(3)6-8(2)7-10(11)4/h6-7H,5H2,1-4H3 |
| Numero CAS |
1754-55-8 |
| EINECS |
217-143-1 |
| Struttura molecolare |
|
| Densità |
0.997g/cm3 |
| Punto di ebollizione |
257.8°C at 760 mmHg |
| Indice di rifrazione |
1.504 |
| Punto d'infiammabilità |
113.8°C |
| Pressione di vapore |
0.0143mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
