ChemNet > CAS > 183158-34-1 2,3-Dimethylbenzeneboronic acid
183158-34-1 2,3-Dimethylbenzeneboronic acid
| Nome del prodotto |
2,3-Dimethylbenzeneboronic acid |
| Nome inglese |
2,3-Dimethylbenzeneboronic acid; 2,3-Dimethylphenylboronic acid; O-XYLENE-3-BORONIC ACID; 2,3-dimethyl acid |
| Formula molecolare |
C8H11BO2 |
| Peso Molecolare |
149.9827 |
| InChI |
InChI=1/C8H11BO2/c1-6-4-3-5-8(7(6)2)9(10)11/h3-5,10-11H,1-2H3 |
| Numero CAS |
183158-34-1 |
| Struttura molecolare |
|
| Densità |
1.07g/cm3 |
| Punto di fusione |
174-180℃ |
| Punto di ebollizione |
312.6°C at 760 mmHg |
| Indice di rifrazione |
1.523 |
| Punto d'infiammabilità |
142.8°C |
| Pressione di vapore |
0.000224mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
