18536-91-9 Dodecyltriethoxysilane
Nome del prodotto |
Dodecyltriethoxysilane |
Nome inglese |
Dodecyltriethoxysilane; n-Dodecyltriethoxysilane; n-Diethoxytrethoxysilane; hexadecane-2,15-dione |
Formula molecolare |
C16H30O2 |
Peso Molecolare |
254.4082 |
InChI |
InChI=1/C16H30O2/c1-15(17)13-11-9-7-5-3-4-6-8-10-12-14-16(2)18/h3-14H2,1-2H3 |
Numero CAS |
18536-91-9 |
EINECS |
242-409-9 |
Struttura molecolare |
|
Densità |
0.886g/cm3 |
Punto di ebollizione |
353.1°C at 760 mmHg |
Indice di rifrazione |
1.444 |
Punto d'infiammabilità |
132.5°C |
Pressione di vapore |
3.67E-05mmHg at 25°C |
Simboli di pericolo |
|
Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|