ChemNet > CAS > 18719-43-2 diethyl (3-chloropropyl)malonate
18719-43-2 diethyl (3-chloropropyl)malonate
| Nome del prodotto |
diethyl (3-chloropropyl)malonate |
| Nome inglese |
diethyl (3-chloropropyl)malonate; (3-Chloropropyl)malonic acid diethyl ester; diethyl (3-chloropropyl)propanedioate |
| Formula molecolare |
C10H17ClO4 |
| Peso Molecolare |
236.6926 |
| InChI |
InChI=1/C10H17ClO4/c1-3-14-9(12)8(6-5-7-11)10(13)15-4-2/h8H,3-7H2,1-2H3 |
| Numero CAS |
18719-43-2 |
| Struttura molecolare |
|
| Densità |
1.114g/cm3 |
| Punto di ebollizione |
290.2°C at 760 mmHg |
| Indice di rifrazione |
1.447 |
| Punto d'infiammabilità |
111.9°C |
| Pressione di vapore |
0.0021mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
