ChemNet > CAS > 18856-63-8 4-Ethylphenyl isothiocyanate
18856-63-8 4-Ethylphenyl isothiocyanate
| Nome del prodotto |
4-Ethylphenyl isothiocyanate |
| Nome inglese |
4-Ethylphenyl isothiocyanate; 4-Ethylisothiocyanatobenzene; 1-ethyl-4-isothiocyanatobenzene |
| Formula molecolare |
C9H9NS |
| Peso Molecolare |
163.2395 |
| InChI |
InChI=1/C9H9NS/c1-2-8-3-5-9(6-4-8)10-7-11/h3-6H,2H2,1H3 |
| Numero CAS |
18856-63-8 |
| Struttura molecolare |
|
| Densità |
1.01g/cm3 |
| Punto di ebollizione |
257.8°C at 760 mmHg |
| Indice di rifrazione |
1.553 |
| Punto d'infiammabilità |
110.2°C |
| Pressione di vapore |
0.0229mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
