ChemNet > CAS > 1963-36-6 4-Methoxycinnamaldehyde
1963-36-6 4-Methoxycinnamaldehyde
| Nome del prodotto |
4-Methoxycinnamaldehyde |
| Nome inglese |
4-Methoxycinnamaldehyde;2-Propenal, 3-(4-methoxyphenyl)-; 3-(4-Methoxyphenyl)-2-propenal; AI3-05957; Cinnamaldehyde, p-methoxy-; FEMA No. 3567; NSC 26454; p-Methoxycinnamaldehyde; p-Methoxycinnamic aldehyde; Cinnamaldehyde, p-methoxy- (8CI); Methoxycinnamaldehyde, p-; 3-(4-methoxyphenyl)prop-2-enal; (2E)-3-(4-methoxyphenyl)prop-2-enal |
| Formula molecolare |
C10H10O2 |
| Peso Molecolare |
162.1852 |
| InChI |
InChI=1/C10H10O2/c1-12-10-6-4-9(5-7-10)3-2-8-11/h2-8H,1H3/b3-2+ |
| Numero CAS |
1963-36-6 |
| EINECS |
217-807-0 |
| Struttura molecolare |
|
| Densità |
1.068g/cm3 |
| Punto di ebollizione |
308.7°C at 760 mmHg |
| Indice di rifrazione |
1.559 |
| Punto d'infiammabilità |
146.5°C |
| Pressione di vapore |
0.00067mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
