ChemNet > CAS > 1968-40-7 Ethyl pent-4-enoate
1968-40-7 Ethyl pent-4-enoate
| Nome del prodotto |
Ethyl pent-4-enoate |
| Nome inglese |
Ethyl pent-4-enoate; Ethyl pent-4-enoate, (Ethyl allylacetate; Pent-4-enoic aci; Ethyl allylacetate; 4-Pentenoic acid ethyl ester; Ethyl 4-pentenoate |
| Formula molecolare |
C7H12O2 |
| Peso Molecolare |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-3-5-6-7(8)9-4-2/h3H,1,4-6H2,2H3 |
| Numero CAS |
1968-40-7 |
| EINECS |
217-818-0 |
| Struttura molecolare |
|
| Densità |
0.898g/cm3 |
| Punto di ebollizione |
122.8°C at 760 mmHg |
| Indice di rifrazione |
1.418 |
| Punto d'infiammabilità |
33.7°C |
| Pressione di vapore |
13.7mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
