ChemNet > CAS > 2113-51-1 2-Iodobiphenyl
2113-51-1 2-Iodobiphenyl
| Nome del prodotto |
2-Iodobiphenyl |
| Nome inglese |
2-Iodobiphenyl;1,1'-Biphenyl, 2-iodo-; 2-Iodo-1,1'-biphenyl; AI3-15371; Biphenyl, 2-iodo-; NSC 9283; o-Iodobiphenyl; o-Phenyliodobenzene; Biphenyl, 2-iodo- (6CI,7CI,8CI) |
| Formula molecolare |
C12H9I |
| Peso Molecolare |
280.1043 |
| InChI |
InChI=1/C12H9I/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H |
| Numero CAS |
2113-51-1 |
| EINECS |
218-303-3 |
| Struttura molecolare |
|
| Densità |
1.584g/cm3 |
| Punto di ebollizione |
331.7°C at 760 mmHg |
| Indice di rifrazione |
1.64 |
| Punto d'infiammabilità |
150.1°C |
| Pressione di vapore |
0.000295mmHg at 25°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
