ChemNet > CAS > 21327-86-6 2-Chloro-6-Methylbenzoic Acid
21327-86-6 2-Chloro-6-Methylbenzoic Acid
| Nome del prodotto |
2-Chloro-6-Methylbenzoic Acid |
| Nome inglese |
2-Chloro-6-Methylbenzoic Acid; 6-Chloro-o-toluic acid (COOH=1); 6-Chloro-o-toluic acid; Benzoic acid,2-chloro-6-methyl-; 2-Choro-6-methyl-benzoic acid |
| Formula molecolare |
C8H7ClO2 |
| Peso Molecolare |
170.593 |
| InChI |
InChI=1/C8H7ClO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| Numero CAS |
21327-86-6 |
| Struttura molecolare |
|
| Densità |
1.31g/cm3 |
| Punto di ebollizione |
289.9°C at 760 mmHg |
| Indice di rifrazione |
1.573 |
| Punto d'infiammabilità |
129.2°C |
| Pressione di vapore |
0.000984mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
