2142-70-3 2-Iodoacetophenone
Nome del prodotto |
2-Iodoacetophenone |
Nome inglese |
2-Iodoacetophenone; 2'-iodoacetophenone; 1-(2-iodophenyl)ethanone; Iodoacetophenone, 2'- |
Formula molecolare |
C8H7IO |
Peso Molecolare |
246.045 |
InChI |
InChI=1/C8H7IO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
Numero CAS |
2142-70-3 |
Struttura molecolare |
|
Densità |
1.72g/cm3 |
Punto di ebollizione |
268.2°C at 760 mmHg |
Indice di rifrazione |
1.603 |
Punto d'infiammabilità |
116°C |
Pressione di vapore |
0.00779mmHg at 25°C |
Simboli di pericolo |
|
Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|