ChemNet > CAS > 22900-83-0 ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate
22900-83-0 ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate
| Nome del prodotto |
ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate |
| Nome inglese |
ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate; ethyl 2-bromo-4-methylthiazole-5-carboxylate |
| Formula molecolare |
C7H8BrNO2S |
| Peso Molecolare |
250.1129 |
| InChI |
InChI=1/C7H8BrNO2S/c1-3-11-6(10)5-4(2)9-7(8)12-5/h3H2,1-2H3 |
| Numero CAS |
22900-83-0 |
| Struttura molecolare |
|
| Densità |
1.573g/cm3 |
| Punto di fusione |
68℃ |
| Punto di ebollizione |
287.086°C at 760 mmHg |
| Indice di rifrazione |
1.563 |
| Punto d'infiammabilità |
127.426°C |
| Pressione di vapore |
0.003mmHg at 25°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
